EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO10S2 |
| Net Charge | 0 |
| Average Mass | 425.437 |
| Monoisotopic Mass | 425.04504 |
| SMILES | O=S(=O)(O)ON=C(Cc1ccc(O)cc1)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19NO10S2/c16-6-9-11(18)12(19)13(20)14(24-9)26-10(15-25-27(21,22)23)5-7-1-3-8(17)4-2-7/h1-4,9,11-14,16-20H,5-6H2,(H,21,22,23)/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | WWBNBPSEKLOHJU-LPUQOGTASA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sinalbin (CHEBI:9151) is a glucosinolic acid (CHEBI:79316) |
| Synonyms | Source |
|---|---|
| p-Hydroxybenzyl glucosinolate | KEGG COMPOUND |
| Sinalbin | KEGG COMPOUND |