EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H18ClFN4O2 |
| Net Charge | 0 |
| Average Mass | 448.885 |
| Monoisotopic Mass | 448.11023 |
| SMILES | C=CC(=O)Nc1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C24H18ClFN4O2/c1-2-23(31)29-17-6-8-21-19(11-17)24(28-14-27-21)30-18-7-9-22(20(25)12-18)32-13-15-4-3-5-16(26)10-15/h2-12,14H,1,13H2,(H,29,31)(H,27,28,30) |
| InChIKey | MVZGYPSXNDCANY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-quinazolinyl]-2-propenamide (CHEBI:91467) has role antineoplastic agent (CHEBI:35610) |
| N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-quinazolinyl]-2-propenamide (CHEBI:91467) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| ALL-3 | ChEMBL |
| allitinib | ChEMBL |
| Allitinib | ChEMBL |
| Als 1306 | ChEMBL |
| Ast 1306 | ChEMBL |
| Ast-1306 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1225 | LINCS |
| Citations |
|---|