EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O3S |
| Net Charge | 0 |
| Average Mass | 371.462 |
| Monoisotopic Mass | 371.13036 |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)C(=Cc1cc3c(n1)CCCC3)C(=O)N2 |
| InChI | InChI=1S/C19H21N3O3S/c1-22(2)26(24,25)14-7-8-18-15(11-14)16(19(23)21-18)10-13-9-12-5-3-4-6-17(12)20-13/h7-11,20H,3-6H2,1-2H3,(H,21,23) |
| InChIKey | LOGJQOUIVKBFGH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SU6656 (CHEBI:91462) has role antineoplastic agent (CHEBI:35610) |
| SU6656 (CHEBI:91462) has role Aurora kinase inhibitor (CHEBI:70770) |
| SU6656 (CHEBI:91462) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| SU6656 (CHEBI:91462) is a oxindoles (CHEBI:38459) |
| SU6656 (CHEBI:91462) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N,N-dimethyl-2-oxo-3-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylene)indoline-5-sulfonamide |
| Synonyms | Source |
|---|---|
| SU 6656 | ChemIDplus |
| SU-6656 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1219 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:330161-87-0 | ChemIDplus |
| Citations |
|---|