EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29ClN2O4S |
| Net Charge | 0 |
| Average Mass | 501.048 |
| Monoisotopic Mass | 500.15366 |
| SMILES | COc1ccc(S(=O)(=O)N(CCO)c2ccccc2CN(C)C/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H29ClN2O4S/c1-28(17-5-6-21-9-11-23(27)12-10-21)20-22-7-3-4-8-26(22)29(18-19-30)34(31,32)25-15-13-24(33-2)14-16-25/h3-16,30H,17-20H2,1-2H3/b6-5+ |
| InChIKey | LLLQTDSSHZREGW-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.17 (Ca(2+)/calmodulin-dependent protein kinase) inhibitor Any EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of a Ca2+/calmodulin-dependent protein kinase (EC 2.7.11.17). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KN-93 (CHEBI:91460) has role EC 2.7.11.17 (Ca2+/calmodulin-dependent protein kinase) inhibitor (CHEBI:131794) |
| KN-93 (CHEBI:91460) has role geroprotector (CHEBI:176497) |
| KN-93 (CHEBI:91460) is a monochlorobenzenes (CHEBI:83403) |
| KN-93 (CHEBI:91460) is a monomethoxybenzene (CHEBI:25235) |
| KN-93 (CHEBI:91460) is a primary alcohol (CHEBI:15734) |
| KN-93 (CHEBI:91460) is a sulfonamide (CHEBI:35358) |
| KN-93 (CHEBI:91460) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[2-({[(2E)-3-(4-chlorophenyl)prop-2-en-1-yl](methyl)amino}methyl)phenyl]-N-(2-hydroxyethyl)-4-methoxybenzenesulfonamide |
| Synonyms | Source |
|---|---|
| KN 93 | ChemIDplus |
| KN93 | ChEBI |
| N-[2-[[3-(4-chlorophenyl)prop-2-enyl-methylamino]methyl]phenyl]-N-(2-hydroxyethyl)-4-methoxybenzenesulfonamide | LINCS |
| Manual Xrefs | Databases |
|---|---|
| LSM-42804 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8359108 | Reaxys |
| CAS:139298-40-1 | ChemIDplus |
| Citations |
|---|