EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H16F6N6O |
| Net Charge | 0 |
| Average Mass | 518.421 |
| Monoisotopic Mass | 518.12898 |
| SMILES | Cn1c(Nc2ccc(C(F)(F)F)cc2)nc2cc(Oc3ccnc(-c4ncc(C(F)(F)F)n4)c3)ccc21 |
| InChI | InChI=1S/C24H16F6N6O/c1-36-19-7-6-15(10-17(19)34-22(36)33-14-4-2-13(3-5-14)23(25,26)27)37-16-8-9-31-18(11-16)21-32-12-20(35-21)24(28,29)30/h2-12H,1H3,(H,32,35)(H,33,34) |
| InChIKey | YABJJWZLRMPFSI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHIR-265 (CHEBI:91451) has role angiogenesis inhibitor (CHEBI:48422) |
| CHIR-265 (CHEBI:91451) has role antineoplastic agent (CHEBI:35610) |
| CHIR-265 (CHEBI:91451) has role antiviral agent (CHEBI:22587) |
| CHIR-265 (CHEBI:91451) has role apoptosis inducer (CHEBI:68495) |
| CHIR-265 (CHEBI:91451) has role B-Raf inhibitor (CHEBI:75047) |
| CHIR-265 (CHEBI:91451) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| CHIR-265 (CHEBI:91451) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| CHIR-265 (CHEBI:91451) is a aromatic ether (CHEBI:35618) |
| CHIR-265 (CHEBI:91451) is a benzimidazoles (CHEBI:22715) |
| CHIR-265 (CHEBI:91451) is a imidazoles (CHEBI:24780) |
| CHIR-265 (CHEBI:91451) is a organofluorine compound (CHEBI:37143) |
| CHIR-265 (CHEBI:91451) is a pyridines (CHEBI:26421) |
| CHIR-265 (CHEBI:91451) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 1-methyl-5-({2-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridin-4-yl}oxy)-N-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-2-amine |
| Synonyms | Source |
|---|---|
| CHIR 265 | ChEBI |
| CHIR265 | ChEBI |
| RAF 265 | ChEBI |
| RAF-265 | ChEBI |
| RAF265 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 55J | PDBeChem |
| LSM-1207 | LINCS |
| WO2011044072 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:927880-90-8 | ChEBI |
| Citations |
|---|