EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N7O |
| Net Charge | 0 |
| Average Mass | 309.333 |
| Monoisotopic Mass | 309.13381 |
| SMILES | CC(C)n1nc(-c2ccc3oc(N)nc3c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H15N7O/c1-7(2)22-14-11(13(16)18-6-19-14)12(21-22)8-3-4-10-9(5-8)20-15(17)23-10/h3-7H,1-2H3,(H2,17,20)(H2,16,18,19) |
| InChIKey | GYLDXIAOMVERTK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapanisertib (CHEBI:91450) has role antineoplastic agent (CHEBI:35610) |
| sapanisertib (CHEBI:91450) has role apoptosis inducer (CHEBI:68495) |
| sapanisertib (CHEBI:91450) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| sapanisertib (CHEBI:91450) has role mTOR inhibitor (CHEBI:68481) |
| sapanisertib (CHEBI:91450) is a 1,3-benzoxazoles (CHEBI:51548) |
| sapanisertib (CHEBI:91450) is a aromatic amine (CHEBI:33860) |
| sapanisertib (CHEBI:91450) is a primary amino compound (CHEBI:50994) |
| sapanisertib (CHEBI:91450) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 3-(2-amino-1,3-benzoxazol-5-yl)-1-(propan-2-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| INNs | Source |
|---|---|
| sapanisertib | WHO MedNet |
| sapanisertibum | WHO MedNet |
| sapanisertib | WHO MedNet |
| sapanisertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-(4-amino-1-propan-2-yl-3-pyrazolo[3,4-d]pyrimidinyl)-1,3-benzoxazol-2-amine | ChEBI |
| TAK-228 | DrugBank |
| INK128 | DrugBank |
| MLN0128 | DrugBank |
| INK-128 | ChEBI |
| TAK 228 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1206 | LINCS |
| DB11836 | DrugBank |
| HMDB0244472 | HMDB |
| D11183 | KEGG DRUG |
| FE5 | PDBeChem |
| Sapanisertib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1224844-38-5 | KEGG DRUG |
| Citations |
|---|