EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20F3N5O3S |
| Net Charge | 0 |
| Average Mass | 491.495 |
| Monoisotopic Mass | 491.12390 |
| SMILES | CS(=O)(=O)c1cccc(CNc2nc(Nc3ccc4c(c3)CCC(=O)N4)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N5O3S/c1-34(32,33)16-4-2-3-13(9-16)11-26-20-17(22(23,24)25)12-27-21(30-20)28-15-6-7-18-14(10-15)5-8-19(31)29-18/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,29,31)(H2,26,27,28,30) |
| InChIKey | HESLKTSGTIBHJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-573228 (CHEBI:91446) has role angiogenesis inhibitor (CHEBI:48422) |
| PF-573228 (CHEBI:91446) has role antineoplastic agent (CHEBI:35610) |
| PF-573228 (CHEBI:91446) has role apoptosis inducer (CHEBI:68495) |
| PF-573228 (CHEBI:91446) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| PF-573228 (CHEBI:91446) is a aminopyrimidine (CHEBI:38338) |
| PF-573228 (CHEBI:91446) is a benzenes (CHEBI:22712) |
| PF-573228 (CHEBI:91446) is a organofluorine compound (CHEBI:37143) |
| PF-573228 (CHEBI:91446) is a quinolone (CHEBI:23765) |
| PF-573228 (CHEBI:91446) is a secondary amino compound (CHEBI:50995) |
| PF-573228 (CHEBI:91446) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 6-{[4-{[3-(methylsulfonyl)benzyl]amino}-5-(trifluoromethyl)pyrimidin-2-yl]amino}-3,4-dihydroquinolin-2(1H)-one |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-6-[[4-[[[3-(methylsulfonyl)phenyl]methyl]amino]-5-(trifluoromethyl)-2-pyrimidinyl]amino]-2(1H)-quinolinone | ChEBI |
| 6-[(4-((3-(methanesulfonyl)benzyl)amino)-5-trifluoromethylpyrimidin-2-yl)amino]-3,4-dihydro-1H-quinolin-2-one | ChEBI |
| 6-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)-2-pyrimidinyl]amino]-3,4-dihydro-1H-quinolin-2-one | ChEBI |
| PF 228 | ChEBI |
| PF-228 | LINCS |
| PF 573,228 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0247536 | HMDB |
| LSM-1200 | LINCS |
| P4N | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:869288-64-2 | ChEBI |
| Citations |
|---|