EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N2O5S |
| Net Charge | 0 |
| Average Mass | 424.478 |
| Monoisotopic Mass | 424.10929 |
| SMILES | COc1ccc(S(=O)(=O)N(C(C)=O)c2ccccc2/C=C/c2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-17(25)24(30(27,28)21-11-9-20(29-2)10-12-21)22-6-4-3-5-19(22)8-7-18-13-15-23(26)16-14-18/h3-16H,1-2H3/b8-7+ |
| InChIKey | OCKHRKSTDPOHEN-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HMN-214 (CHEBI:91440) has role antineoplastic agent (CHEBI:35610) |
| HMN-214 (CHEBI:91440) has role apoptosis inducer (CHEBI:68495) |
| HMN-214 (CHEBI:91440) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| HMN-214 (CHEBI:91440) has role prodrug (CHEBI:50266) |
| HMN-214 (CHEBI:91440) is a N-sulfonylcarboxamide (CHEBI:90852) |
| HMN-214 (CHEBI:91440) is a monomethoxybenzene (CHEBI:25235) |
| HMN-214 (CHEBI:91440) is a olefinic compound (CHEBI:78840) |
| HMN-214 (CHEBI:91440) is a pyridine N-oxides (CHEBI:38189) |
| IUPAC Name |
|---|
| N-[(4-methoxyphenyl)sulfonyl]-N-{2-[(E)-2-(1-oxidopyridin-4-yl)ethenyl]phenyl}acetamide |
| Synonyms | Source |
|---|---|
| N-[(4-methoxyphenyl)sulfonyl]-N-[2-[(1E)-2-(1-oxido-4-pyridinyl)ethenyl]phenyl]acetamide | ChEBI |
| HMN 214 | ChEBI |
| HMN214 | ChEBI |
| (E)-4-[2-[2-(N-acetyl-N-[4-methoxybenzenesulfonyl]amino)stilbazole]]1-oxide | ChEBI |
| (E)-4-[2-[2-[N-acetyl-N-[(p-methoxyphenyl)sulfonyl]amino]phenyl]ethenyl]pyridine 1-oxide | ChEBI |
| IVX 214 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1192 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:173529-46-9 | ChEBI |
| Citations |
|---|