EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | [H][C@]1(c2ccc(O)c(OC)c2)Oc2cc([C@@]3([H])Oc4cc(O)cc(O)c4C(=O)[C@@H]3O)ccc2O[C@@H]1CO |
| InChI | InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-16-5-3-12(7-18(16)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20-,23+,24-,25-/m1/s1 |
| InChIKey | SEBFKMXJBCUCAI-HKTJVKLFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| silibinin (CHEBI:9144) has role antineoplastic agent (CHEBI:35610) |
| silibinin (CHEBI:9144) has role antioxidant (CHEBI:22586) |
| silibinin (CHEBI:9144) has role hepatoprotective agent (CHEBI:62868) |
| silibinin (CHEBI:9144) has role plant metabolite (CHEBI:76924) |
| silibinin (CHEBI:9144) is a aromatic ether (CHEBI:35618) |
| silibinin (CHEBI:9144) is a benzodioxine (CHEBI:64096) |
| silibinin (CHEBI:9144) is a flavonolignan (CHEBI:72709) |
| silibinin (CHEBI:9144) is a polyphenol (CHEBI:26195) |
| silibinin (CHEBI:9144) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-[(2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-chromen-4-one |
| INNs | Source |
|---|---|
| silibinin | KEGG DRUG |
| silibinina | WHO MedNet |
| silibinine | WHO MedNet |
| silibininum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Silymarin | KEGG COMPOUND |
| Silibinin | KEGG COMPOUND |
| Silibinine | HMDB |
| Karsil | HMDB |
| Flavobin | HMDB |
| Silybin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07610 | KEGG COMPOUND |
| Silibinin | Wikipedia |
| D08515 | KEGG DRUG |
| HMDB0030583 | HMDB |
| CN102727484 | Patent |
| C00001003 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1632852 | Reaxys |
| CAS:22888-70-6 | KEGG COMPOUND |
| CAS:22888-70-6 | ChemIDplus |
| Citations |
|---|