EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N6O |
| Net Charge | 0 |
| Average Mass | 388.475 |
| Monoisotopic Mass | 388.20116 |
| SMILES | c1cc(OCCN2CCCCC2)cc(-c2nnc3ccc(-c4ncnn4)cc23)c1 |
| InChI | InChI=1S/C22H24N6O/c1-2-9-28(10-3-1)11-12-29-18-6-4-5-16(13-18)21-19-14-17(22-23-15-24-27-22)7-8-20(19)25-26-21/h4-8,13-15H,1-3,9-12H2,(H,25,26)(H,23,24,27) |
| InChIKey | XDJCLCLBSGGNKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[3-[2-(1-piperidinyl)ethoxy]phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole (CHEBI:91437) has role antineoplastic agent (CHEBI:35610) |
| 3-[3-[2-(1-piperidinyl)ethoxy]phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole (CHEBI:91437) is a pyrazoles (CHEBI:26410) |
| 3-[3-[2-(1-piperidinyl)ethoxy]phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole (CHEBI:91437) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| cc-401 | ChEMBL |
| Cc-401 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1186 | LINCS |
| Citations |
|---|