EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18FN5O |
| Net Charge | 0 |
| Average Mass | 375.407 |
| Monoisotopic Mass | 375.14954 |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4nnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C21H18FN5O/c1-12-5-10-16(22)18(11-12)25-21(28)24-14-8-6-13(7-9-14)15-3-2-4-17-19(15)20(23)27-26-17/h2-11H,1H3,(H3,23,26,27)(H2,24,25,28) |
| InChIKey | MPVGZUGXCQEXTM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linifanib (CHEBI:91435) has role angiogenesis inhibitor (CHEBI:48422) |
| linifanib (CHEBI:91435) has role antineoplastic agent (CHEBI:35610) |
| linifanib (CHEBI:91435) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| linifanib (CHEBI:91435) is a aromatic amine (CHEBI:33860) |
| linifanib (CHEBI:91435) is a indazoles (CHEBI:38769) |
| linifanib (CHEBI:91435) is a phenylureas (CHEBI:134043) |
| INNs | Source |
|---|---|
| linifanib | WHO MedNet |
| linifanib | WHO MedNet |
| linifanib | WHO MedNet |
| linifanibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea | LINCS |
| ABT 869 | ChemIDplus |
| ABT-869 | ChemIDplus |
| ABT869 | ChEBI |
| N-[4-(3-amino-1H-indazol-4-yl)phenyl]-N'-(2-fluoro-5-methylphenyl)urea | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11008713 | Reaxys |
| CAS:796967-16-3 | KEGG DRUG |
| CAS:796967-16-3 | ChemIDplus |
| Citations |
|---|