EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18FN5O |
| Net Charge | 0 |
| Average Mass | 375.407 |
| Monoisotopic Mass | 375.14954 |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4nnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C21H18FN5O/c1-12-5-10-16(22)18(11-12)25-21(28)24-14-8-6-13(7-9-14)15-3-2-4-17-19(15)20(23)27-26-17/h2-11H,1H3,(H3,23,26,27)(H2,24,25,28) |
| InChIKey | MPVGZUGXCQEXTM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linifanib (CHEBI:91435) has role angiogenesis inhibitor (CHEBI:48422) |
| linifanib (CHEBI:91435) has role antineoplastic agent (CHEBI:35610) |
| linifanib (CHEBI:91435) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| linifanib (CHEBI:91435) has role ophthalmology drug (CHEBI:66981) |
| linifanib (CHEBI:91435) is a aromatic amine (CHEBI:33860) |
| linifanib (CHEBI:91435) is a indazoles (CHEBI:38769) |
| linifanib (CHEBI:91435) is a phenylureas (CHEBI:134043) |
| INNs | Source |
|---|---|
| linifanib | WHO MedNet |
| linifanib | WHO MedNet |
| linifanib | WHO MedNet |
| linifanibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea | LINCS |
| A-741439 | ChEMBL |
| ABT 869 | ChemIDplus |
| ABT-869 | ChemIDplus |
| ABT869 | ChEBI |
| AL-39324 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11008713 | Reaxys |
| CAS:796967-16-3 | ChemIDplus |
| CAS:796967-16-3 | KEGG DRUG |
| Citations |
|---|