EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16F3N3O2S |
| Net Charge | 0 |
| Average Mass | 443.450 |
| Monoisotopic Mass | 443.09153 |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1sccc1NCc1ccnc2ccccc12 |
| InChI | InChI=1S/C22H16F3N3O2S/c23-22(24,25)30-16-7-5-15(6-8-16)28-21(29)20-19(10-12-31-20)27-13-14-9-11-26-18-4-2-1-3-17(14)18/h1-12,27H,13H2,(H,28,29) |
| InChIKey | FGTCROZDHDSNIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-quinolinylmethylamino)-N-[4-(trifluoromethoxy)phenyl]-2-thiophenecarboxamide (CHEBI:91433) has role antineoplastic agent (CHEBI:35610) |
| 3-(4-quinolinylmethylamino)-N-[4-(trifluoromethoxy)phenyl]-2-thiophenecarboxamide (CHEBI:91433) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| osi-930 | ChEMBL |
| Osi 930 | ChEMBL |
| Osi-930 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1179 | LINCS |
| Citations |
|---|