EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | [H][C@@]1(c2ccc(O)c(OC)c2)Oc2c(O)cc([C@@]3([H])Oc4cc(O)cc(O)c4C(=O)[C@@H]3O)cc2[C@H]1CO |
| InChI | InChI=1S/C25H22O10/c1-33-18-6-10(2-3-15(18)28)23-14(9-26)13-4-11(5-17(30)25(13)35-23)24-22(32)21(31)20-16(29)7-12(27)8-19(20)34-24/h2-8,14,22-24,26-30,32H,9H2,1H3/t14-,22+,23+,24-/m1/s1 |
| InChIKey | BMLIIPOXVWESJG-LMBCONBSSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | prostaglandin antagonist A compound that inhibits the action of prostaglandins. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | prostaglandin antagonist A compound that inhibits the action of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| silychristin (CHEBI:9143) has role lipoxygenase inhibitor (CHEBI:35856) |
| silychristin (CHEBI:9143) has role metabolite (CHEBI:25212) |
| silychristin (CHEBI:9143) has role prostaglandin antagonist (CHEBI:49023) |
| silychristin (CHEBI:9143) has role radical scavenger (CHEBI:48578) |
| silychristin (CHEBI:9143) is a 1-benzofurans (CHEBI:38830) |
| silychristin (CHEBI:9143) is a aromatic ether (CHEBI:35618) |
| silychristin (CHEBI:9143) is a flavonolignan (CHEBI:72709) |
| silychristin (CHEBI:9143) is a polyphenol (CHEBI:26195) |
| silychristin (CHEBI:9143) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-[(2R,3S)-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-5-yl]-2,3-dihydro-4H-chromen-4-one |
| INNs | Source |
|---|---|
| silicristina | ChemIDplus |
| silicristinum | ChemIDplus |
| silicristine | ChemIDplus |
| Synonym | Source |
|---|---|
| Silychristin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6080819 | Reaxys |
| CAS:33889-69-9 | KEGG COMPOUND |
| CAS:33889-69-9 | ChemIDplus |
| Citations |
|---|