EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | [H][C@@]1(c2ccc(O)c(OC)c2)Oc2c(O)cc([C@@]3([H])Oc4cc(O)cc(O)c4C(=O)[C@@H]3O)cc2[C@H]1CO |
| InChI | InChI=1S/C25H22O10/c1-33-18-6-10(2-3-15(18)28)23-14(9-26)13-4-11(5-17(30)25(13)35-23)24-22(32)21(31)20-16(29)7-12(27)8-19(20)34-24/h2-8,14,22-24,26-30,32H,9H2,1H3/t14-,22+,23+,24-/m1/s1 |
| InChIKey | BMLIIPOXVWESJG-LMBCONBSSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. prostaglandin antagonist A compound that inhibits the action of prostaglandins. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | prostaglandin antagonist A compound that inhibits the action of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| silychristin (CHEBI:9143) has role lipoxygenase inhibitor (CHEBI:35856) |
| silychristin (CHEBI:9143) has role metabolite (CHEBI:25212) |
| silychristin (CHEBI:9143) has role prostaglandin antagonist (CHEBI:49023) |
| silychristin (CHEBI:9143) has role radical scavenger (CHEBI:48578) |
| silychristin (CHEBI:9143) is a 1-benzofurans (CHEBI:38830) |
| silychristin (CHEBI:9143) is a aromatic ether (CHEBI:35618) |
| silychristin (CHEBI:9143) is a flavonolignan (CHEBI:72709) |
| silychristin (CHEBI:9143) is a polyphenol (CHEBI:26195) |
| silychristin (CHEBI:9143) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-[(2R,3S)-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1-benzofuran-5-yl]-2,3-dihydro-4H-chromen-4-one |
| INNs | Source |
|---|---|
| silicristina | ChemIDplus |
| silicristine | ChemIDplus |
| silicristinum | ChemIDplus |
| Synonym | Source |
|---|---|
| Silychristin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6080819 | Reaxys |
| CAS:33889-69-9 | ChemIDplus |
| CAS:33889-69-9 | KEGG COMPOUND |
| Citations |
|---|