EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32N8O2 |
| Net Charge | 0 |
| Average Mass | 500.607 |
| Monoisotopic Mass | 500.26482 |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C27H32N8O2/c1-5-13-34-25(36)21-18-28-26(29-19-9-11-20(12-10-19)33-16-14-32(4)15-17-33)31-24(21)35(34)23-8-6-7-22(30-23)27(2,3)37/h5-12,18,37H,1,13-17H2,2-4H3,(H,28,29,31) |
| InChIKey | BKWJAKQVGHWELA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adavosertib (CHEBI:91414) has role antineoplastic agent (CHEBI:35610) |
| adavosertib (CHEBI:91414) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| adavosertib (CHEBI:91414) is a N-arylpiperazine (CHEBI:46848) |
| adavosertib (CHEBI:91414) is a N-methylpiperazine (CHEBI:46920) |
| adavosertib (CHEBI:91414) is a pyrazolopyrimidine (CHEBI:38669) |
| adavosertib (CHEBI:91414) is a pyridines (CHEBI:26421) |
| adavosertib (CHEBI:91414) is a secondary amino compound (CHEBI:50995) |
| adavosertib (CHEBI:91414) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 1-[6-(2-hydroxypropan-2-yl)pyridin-2-yl]-6-[4-(4-methylpiperazin-1-yl)anilino]-2-(prop-2-en-1-yl)-1,2-dihydro-3H-pyrazolo[3,4-d]pyrimidin-3-one |
| INNs | Source |
|---|---|
| adavosertib | WHO MedNet |
| adavosertib | WHO MedNet |
| adavosertib | WHO MedNet |
| adavosertibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZD 1775 | DrugBank |
| AZD-1775 | DrugBank |
| AZD1775 | DrugBank |
| MK 1775 | DrugBank |
| MK-1775 | DrugBank |
| MK1775 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 8X7 | PDBeChem |
| Adavosertib | Wikipedia |
| D11361 | KEGG DRUG |
| DB11740 | DrugBank |
| HMDB0254782 | HMDB |
| LSM-1153 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:955365-80-7 | KEGG DRUG |
| Citations |
|---|