EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H19ClF2N4O4 |
| Net Charge | 0 |
| Average Mass | 512.900 |
| Monoisotopic Mass | 512.10629 |
| SMILES | CCOc1ccn(-c2ccc(F)cc2)c(=O)c1C(=O)Nc1ccc(Oc2ccnc(N)c2Cl)c(F)c1 |
| InChI | InChI=1S/C25H19ClF2N4O4/c1-2-35-19-10-12-32(16-6-3-14(27)4-7-16)25(34)21(19)24(33)31-15-5-8-18(17(28)13-15)36-20-9-11-30-23(29)22(20)26/h3-13H,2H2,1H3,(H2,29,30)(H,31,33) |
| InChIKey | VNBRGSXVFBYQNN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-4-ethoxy-1-(4-fluorophenyl)-2-oxo-3-pyridinecarboxamide (CHEBI:91409) has role antineoplastic agent (CHEBI:35610) |
| N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-4-ethoxy-1-(4-fluorophenyl)-2-oxo-3-pyridinecarboxamide (CHEBI:91409) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| ASLAN-002 | ChEMBL |
| ASLAN002 | ChEMBL |
| bms-777607 | ChEMBL |
| BMS-777607 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1144 | LINCS |
| Citations |
|---|