EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N6O3S |
| Net Charge | 0 |
| Average Mass | 524.691 |
| Monoisotopic Mass | 524.25696 |
| SMILES | Cc1cnc(Nc2ccc(OCCN3CCCC3)cc2)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C27H36N6O3S/c1-20-19-28-26(30-21-10-12-23(13-11-21)36-17-16-33-14-5-6-15-33)31-25(20)29-22-8-7-9-24(18-22)37(34,35)32-27(2,3)4/h7-13,18-19,32H,5-6,14-17H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | JOOXLOJCABQBSG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-tert-butyl-3-[[5-methyl-2-[4-[2-(1-pyrrolidinyl)ethoxy]anilino]-4-pyrimidinyl]amino]benzenesulfonamide (CHEBI:91408) has role antifibrotic agent (CHEBI:233423) |
| N-tert-butyl-3-[[5-methyl-2-[4-[2-(1-pyrrolidinyl)ethoxy]anilino]-4-pyrimidinyl]amino]benzenesulfonamide (CHEBI:91408) has role antineoplastic agent (CHEBI:35610) |
| N-tert-butyl-3-[[5-methyl-2-[4-[2-(1-pyrrolidinyl)ethoxy]anilino]-4-pyrimidinyl]amino]benzenesulfonamide (CHEBI:91408) has role renoprotective agent (CHEBI:231911) |
| N-tert-butyl-3-[[5-methyl-2-[4-[2-(1-pyrrolidinyl)ethoxy]anilino]-4-pyrimidinyl]amino]benzenesulfonamide (CHEBI:91408) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| fedratinib | ChEMBL |
| Fedratinib | ChEMBL |
| SAR-302503 | ChEMBL |
| SAR302503 | ChEMBL |
| TG-101348 | ChEMBL |
| TG101348 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1142 | LINCS |
| Citations |
|---|