EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N6O2 |
| Net Charge | 0 |
| Average Mass | 414.469 |
| Monoisotopic Mass | 414.18042 |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H22N6O2/c24-10-12-25-22(30)18-3-1-17(2-4-18)21-9-11-26-23(28-21)27-19-5-7-20(8-6-19)29-13-15-31-16-14-29/h1-9,11H,12-16H2,(H,25,30)(H,26,27,28) |
| InChIKey | ZVHNDZWQTBEVRY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| momelotinib (CHEBI:91407) has role anti-anaemic agent (CHEBI:75835) |
| momelotinib (CHEBI:91407) has role antineoplastic agent (CHEBI:35610) |
| momelotinib (CHEBI:91407) has role apoptosis inducer (CHEBI:68495) |
| momelotinib (CHEBI:91407) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| momelotinib (CHEBI:91407) is a aminopyrimidine (CHEBI:38338) |
| momelotinib (CHEBI:91407) is a benzamides (CHEBI:22702) |
| momelotinib (CHEBI:91407) is a morpholines (CHEBI:38785) |
| momelotinib (CHEBI:91407) is a nitrile (CHEBI:18379) |
| momelotinib (CHEBI:91407) is a secondary amino compound (CHEBI:50995) |
| momelotinib (CHEBI:91407) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(cyanomethyl)-4-{2-[4-(morpholin-4-yl)anilino]pyrimidin-4-yl}benzamide |
| INNs | Source |
|---|---|
| momelotinib | WHO MedNet |
| momelotinib | WHO MedNet |
| momélotinib | WHO MedNet |
| momelotinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CYT 11387 | ChEBI |
| CYT-11387 | ChEBI |
| CYT 387 | ChEBI |
| CYT-387 | DrugBank |
| CYT387 | ChemIDplus |
| N-(cyanomethyl)-4-[2-[4-(4-morpholinyl)anilino]-4-pyrimidinyl]benzamide | ChEBI |
| Brand Name | Source |
|---|---|
| Ojjaara | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C87 | PDBeChem |
| D10315 | KEGG DRUG |
| DB11763 | DrugBank |
| LSM-1141 | LINCS |
| Momelotinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1056634-68-4 | ChemIDplus |
| Citations |
|---|