EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23N5O |
| Net Charge | 0 |
| Average Mass | 421.504 |
| Monoisotopic Mass | 421.19026 |
| SMILES | [H][C@]1(c2nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c3c(N)nccn32)C[C@@](C)(O)C1 |
| InChI | InChI=1S/C26H23N5O/c1-26(32)14-19(15-26)25-30-22(23-24(27)28-11-12-31(23)25)18-8-7-17-9-10-20(29-21(17)13-18)16-5-3-2-4-6-16/h2-13,19,32H,14-15H2,1H3,(H2,27,28)/t19-,26+ |
| InChIKey | PKCDDUHJAFVJJB-VLZXCDOPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. insulin-like growth factor receptor 1 antagonist An antagonist at the insulin-like growth factor receptor 1. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linsitinib (CHEBI:91402) has role antimycobacterial drug (CHEBI:64912) |
| linsitinib (CHEBI:91402) has role antineoplastic agent (CHEBI:35610) |
| linsitinib (CHEBI:91402) has role apoptosis inducer (CHEBI:68495) |
| linsitinib (CHEBI:91402) has role insulin-like growth factor receptor 1 antagonist (CHEBI:75252) |
| linsitinib (CHEBI:91402) is a aromatic amine (CHEBI:33860) |
| linsitinib (CHEBI:91402) is a benzenes (CHEBI:22712) |
| linsitinib (CHEBI:91402) is a cyclobutanes (CHEBI:156473) |
| linsitinib (CHEBI:91402) is a imidazopyrazine (CHEBI:37847) |
| linsitinib (CHEBI:91402) is a quinolines (CHEBI:26513) |
| linsitinib (CHEBI:91402) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| cis-3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutanol |
| INNs | Source |
|---|---|
| linsitinib | WHO MedNet |
| linsitinib | WHO MedNet |
| linsitinib | WHO MedNet |
| linsitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ASP-7487 | DrugBank |
| cis-3-[8-amino-1-(2-phenyl-7-quinolinyl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutanol | ChEBI |
| OSI 906 | ChEBI |
| OSI-906 | DrugBank |
| OSI906 | ChEBI |
| OSI 906AA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09925 | KEGG DRUG |
| DB06075 | DrugBank |
| EP2427192 | Patent |
| HMDB0254107 | HMDB |
| Linsitinib | Wikipedia |
| LSM-1135 | LINCS |
| WO2011163430 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:867160-71-2 | KEGG DRUG |
| Citations |
|---|