EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23N5O |
| Net Charge | 0 |
| Average Mass | 421.504 |
| Monoisotopic Mass | 421.19026 |
| SMILES | [H][C@]1(c2nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c3c(N)nccn32)C[C@@](C)(O)C1 |
| InChI | InChI=1S/C26H23N5O/c1-26(32)14-19(15-26)25-30-22(23-24(27)28-11-12-31(23)25)18-8-7-17-9-10-20(29-21(17)13-18)16-5-3-2-4-6-16/h2-13,19,32H,14-15H2,1H3,(H2,27,28)/t19-,26+ |
| InChIKey | PKCDDUHJAFVJJB-VLZXCDOPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. insulin-like growth factor receptor 1 antagonist An antagonist at the insulin-like growth factor receptor 1. |
| Applications: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linsitinib (CHEBI:91402) has role antimycobacterial drug (CHEBI:64912) |
| linsitinib (CHEBI:91402) has role antineoplastic agent (CHEBI:35610) |
| linsitinib (CHEBI:91402) has role apoptosis inducer (CHEBI:68495) |
| linsitinib (CHEBI:91402) has role insulin-like growth factor receptor 1 antagonist (CHEBI:75252) |
| linsitinib (CHEBI:91402) is a aromatic amine (CHEBI:33860) |
| linsitinib (CHEBI:91402) is a benzenes (CHEBI:22712) |
| linsitinib (CHEBI:91402) is a cyclobutanes (CHEBI:156473) |
| linsitinib (CHEBI:91402) is a imidazopyrazine (CHEBI:37847) |
| linsitinib (CHEBI:91402) is a quinolines (CHEBI:26513) |
| linsitinib (CHEBI:91402) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| cis-3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutanol |
| INNs | Source |
|---|---|
| linsitinib | WHO MedNet |
| linsitinib | WHO MedNet |
| linsitinib | WHO MedNet |
| linsitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| OSI-906AA | DrugBank |
| OSI-906 | DrugBank |
| ASP-7487 | DrugBank |
| OSI 906AA | ChEBI |
| OSI 906 | ChEBI |
| cis-3-[8-amino-1-(2-phenyl-7-quinolinyl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1135 | LINCS |
| DB06075 | DrugBank |
| HMDB0254107 | HMDB |
| D09925 | KEGG DRUG |
| Linsitinib | Wikipedia |
| WO2011163430 | Patent |
| EP2427192 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:867160-71-2 | KEGG DRUG |
| Citations |
|---|