EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N4O2S2 |
| Net Charge | 0 |
| Average Mass | 380.539 |
| Monoisotopic Mass | 380.13407 |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(NC(=O)C3CCNCC3)s2)o1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-17(2,3)12-8-19-13(23-12)10-24-14-9-20-16(25-14)21-15(22)11-4-6-18-7-5-11/h8-9,11,18H,4-7,10H2,1-3H3,(H,20,21,22) |
| InChIKey | OUSFTKFNBAZUKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) has role angiogenesis inhibitor (CHEBI:48422) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) has role antineoplastic agent (CHEBI:35610) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) has role apoptosis inducer (CHEBI:68495) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) is a 1,3-oxazoles (CHEBI:46812) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) is a 1,3-thiazoles (CHEBI:38418) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) is a organic sulfide (CHEBI:16385) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) is a piperidinecarboxamide (CHEBI:48592) |
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide (CHEBI:91399) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(5-{[(5-tert-butyl-1,3-oxazol-2-yl)methyl]sulfanyl}-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| Synonyms | Source |
|---|---|
| bms-387032 | ChEMBL |
| Bms387032 | ChEMBL |
| BMS 387032 | ChemIDplus |
| BMS-387032 | ChemIDplus |
| N-(5-(((5-(1,1-dimethylethyl)-2-oxazolyl)methyl)thio)-2-thiazolyl)-4-piperidinecarboxamide | ChemIDplus |
| SNS 032 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:345627-80-7 | ChemIDplus |
| Citations |
|---|