EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H19N3O2 |
| Net Charge | 0 |
| Average Mass | 369.424 |
| Monoisotopic Mass | 369.14773 |
| SMILES | O=C1NC(=O)[C@@H](c2cn3c4c(cccc24)CCC3)[C@@H]1c1cnc2ccccc12 |
| InChI | InChI=1S/C23H19N3O2/c27-22-19(16-11-24-18-9-2-1-7-14(16)18)20(23(28)25-22)17-12-26-10-4-6-13-5-3-8-15(17)21(13)26/h1-3,5,7-9,11-12,19-20,24H,4,6,10H2,(H,25,27,28)/t19-,20-/m0/s1 |
| InChIKey | UCEQXRCJXIVODC-PMACEKPBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-1131 (CHEBI:91398) has role antineoplastic agent (CHEBI:35610) |
| LSM-1131 (CHEBI:91398) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| tivantinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ARQ 197 | ChEMBL |
| ARQ-197 | ChEMBL |
| tivantinib | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1131 | LINCS |
| Citations |
|---|