EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N5O3S |
| Net Charge | 0 |
| Average Mass | 447.520 |
| Monoisotopic Mass | 447.13651 |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)N1CCN(c2ncnc3c2oc2ccccc23)CC1 |
| InChI | InChI=1S/C23H21N5O3S/c32-23(24-12-15-5-6-18-19(11-15)30-14-29-18)28-9-7-27(8-10-28)22-21-20(25-13-26-22)16-3-1-2-4-17(16)31-21/h1-6,11,13H,7-10,12,14H2,(H,24,32) |
| InChIKey | FOFDIMHVKGYHRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(1,3-benzodioxol-5-ylmethyl)-4-(4-benzofuro[3,2-d]pyrimidinyl)-1-piperazinecarbothioamide (CHEBI:91389) has role antineoplastic agent (CHEBI:35610) |
| N-(1,3-benzodioxol-5-ylmethyl)-4-(4-benzofuro[3,2-d]pyrimidinyl)-1-piperazinecarbothioamide (CHEBI:91389) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| amuvatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| amuvatinib | ChEMBL |
| HPK 56 | ChEMBL |
| HPK-56 | ChEMBL |
| HPK56 | ChEMBL |
| MP 470 | ChEMBL |
| MP-470 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1118 | LINCS |
| Citations |
|---|