EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N7O2 |
| Net Charge | 0 |
| Average Mass | 419.489 |
| Monoisotopic Mass | 419.20697 |
| SMILES | Cn1cc(C2=Nc3cc(NC(=O)[C@H](N)C4CCCCC4)cc4c3C2=CNNC4=O)cn1 |
| InChI | InChI=1S/C22H25N7O2/c1-29-11-13(9-25-29)20-16-10-24-28-21(30)15-7-14(8-17(27-20)18(15)16)26-22(31)19(23)12-5-3-2-4-6-12/h7-12,19,24H,2-6,23H2,1H3,(H,26,31)(H,28,30)/t19-/m1/s1 |
| InChIKey | YFNWWNRZJGMDBR-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-00477736 (CHEBI:91385) has role antineoplastic agent (CHEBI:35610) |
| PF-00477736 (CHEBI:91385) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| PF-00477736 (CHEBI:91385) is a amino acid amide (CHEBI:22475) |
| PF-00477736 (CHEBI:91385) is a diazepinoindole (CHEBI:134605) |
| PF-00477736 (CHEBI:91385) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| (2R)-2-amino-2-cyclohexyl-N-[2-(1-methyl-1H-pyrazol-4-yl)-6-oxo-5,6-dihydro-4H-[1,2]diazepino[4,5,6-cd]indol-8-yl]acetamide |
| Synonyms | Source |
|---|---|
| PF 477736 | ChEBI |
| PF-477736 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1112 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:952021-60-2 | ChemIDplus |
| Citations |
|---|