EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O9 |
| Net Charge | 0 |
| Average Mass | 466.442 |
| Monoisotopic Mass | 466.12638 |
| SMILES | [H][C@@]1(c2ccc3c(c2)O[C@H](CO)[C@@]([H])(c2ccc(O)c(OC)c2)O3)CC(=O)c2c(O)cc(O)cc2O1 |
| InChI | InChI=1S/C25H22O9/c1-31-20-7-13(2-4-15(20)28)25-23(11-26)33-21-6-12(3-5-18(21)34-25)19-10-17(30)24-16(29)8-14(27)9-22(24)32-19/h2-9,19,23,25-29H,10-11H2,1H3/t19-,23+,25+/m0/s1 |
| InChIKey | CRPGUMMYQABYES-DNVKUUNQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| silandrin (CHEBI:9138) has role hepatoprotective agent (CHEBI:62868) |
| silandrin (CHEBI:9138) has role metabolite (CHEBI:25212) |
| silandrin (CHEBI:9138) is a aromatic ether (CHEBI:35618) |
| silandrin (CHEBI:9138) is a benzodioxine (CHEBI:64096) |
| silandrin (CHEBI:9138) is a flavonolignan (CHEBI:72709) |
| silandrin (CHEBI:9138) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-[(2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (−)-silandrin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08600 | KEGG COMPOUND |
| HMDB0033325 | HMDB |
| LMPK12140414 | LIPID MAPS |
| C00001002 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4772951 | Reaxys |
| CAS:70815-32-6 | KEGG COMPOUND |
| Citations |
|---|