EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31N5O4 |
| Net Charge | 0 |
| Average Mass | 513.598 |
| Monoisotopic Mass | 513.23760 |
| SMILES | COc1cc2c(Nc3ccc(NC(=O)c4ccccc4)cc3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C29H31N5O4/c1-36-26-18-24-25(19-27(26)38-15-5-12-34-13-16-37-17-14-34)30-20-31-28(24)32-22-8-10-23(11-9-22)33-29(35)21-6-3-2-4-7-21/h2-4,6-11,18-20H,5,12-17H2,1H3,(H,33,35)(H,30,31,32) |
| InChIKey | OGNYUTNQZVRGMN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ZM447439 (CHEBI:91376) has role antineoplastic agent (CHEBI:35610) |
| ZM447439 (CHEBI:91376) has role apoptosis inducer (CHEBI:68495) |
| ZM447439 (CHEBI:91376) has role Aurora kinase inhibitor (CHEBI:70770) |
| ZM447439 (CHEBI:91376) is a aromatic ether (CHEBI:35618) |
| ZM447439 (CHEBI:91376) is a benzamides (CHEBI:22702) |
| ZM447439 (CHEBI:91376) is a morpholines (CHEBI:38785) |
| ZM447439 (CHEBI:91376) is a polyether (CHEBI:46774) |
| ZM447439 (CHEBI:91376) is a quinazolines (CHEBI:38530) |
| ZM447439 (CHEBI:91376) is a secondary amino compound (CHEBI:50995) |
| ZM447439 (CHEBI:91376) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[4-({6-methoxy-7-[3-(morpholin-4-yl)propoxy]quinazolin-4-yl}amino)phenyl]benzamide |
| Synonyms | Source |
|---|---|
| ZM447439 | ChemIDplus |
| ZM-447439 | ChemIDplus |
| ZM 447439 | ChEBI |
| N-(4-((6-methoxy-7-(3-(4-morpholinyl)propoxy)-4-quinazolinyl)amino)phenyl)benzamide | ChemIDplus |
| N-[4-[[6-methoxy-7-(3-morpholinopropoxy)quinazolin-4-yl]amino]phenyl]benzamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:331771-20-1 | ChemIDplus |
| Citations |
|---|