EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17NO3S2 |
| Net Charge | 0 |
| Average Mass | 395.505 |
| Monoisotopic Mass | 395.06499 |
| SMILES | O=c1cc(-c2cccc3c2Sc2ccccc2S3)oc(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H17NO3S2/c23-14-12-16(25-20(13-14)22-8-10-24-11-9-22)15-4-3-7-19-21(15)27-18-6-2-1-5-17(18)26-19/h1-7,12-13H,8-11H2 |
| InChIKey | XRKYMMUGXMWDAO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KU-55933 (CHEBI:228209) has role antineoplastic agent (CHEBI:35610) |
| KU-55933 (CHEBI:228209) has role apoptosis inducer (CHEBI:68495) |
| KU-55933 (CHEBI:228209) has role autophagy inducer (CHEBI:138880) |
| KU-55933 (CHEBI:228209) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| KU-55933 (CHEBI:228209) has role neuroprotective agent (CHEBI:63726) |
| KU-55933 (CHEBI:228209) has role radiosensitizing agent (CHEBI:132992) |
| KU-55933 (CHEBI:228209) is a 4-pyranones (CHEBI:131906) |
| KU-55933 (CHEBI:228209) is a morpholines (CHEBI:38785) |
| KU-55933 (CHEBI:228209) is a thianthrenes (CHEBI:64513) |
| IUPAC Name |
|---|
| 2-(morpholin-4-yl)-6-(thianthren-1-yl)-4H-pyran-4-one |
| Synonyms | Source |
|---|---|
| KU 55933 | ChEBI |
| KU55933 | ChEBI |
| 2-morpholin-4-yl-6-thianthren-1-yl-pyran-4-one | ChEBI |
| 2-(4-morpholinyl)-6-(1-thianthrenyl)-4H-pyran-4-one | ChEBI |
| 2-(4-morpholinyl)-6-(1-thianthrenyl)-4-pyranone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1074 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:587871-26-9 | ChEBI |
| Citations |
|---|