EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9137 - sibutramine
| Formula | C17H26ClN |
| Net Charge | 0 |
| Average Mass | 279.855 |
| Monoisotopic Mass | 279.17538 |
| SMILES | CC(C)CC(N(C)C)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C17H26ClN/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14/h6-9,13,16H,5,10-12H2,1-4H3 |
| InChIKey | UNAANXDKBXWMLN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sibutramine (CHEBI:9137) has role anti-obesity agent (CHEBI:74518) |
| sibutramine (CHEBI:9137) has role serotonin uptake inhibitor (CHEBI:50949) |
| sibutramine (CHEBI:9137) is a organochlorine compound (CHEBI:36683) |
| sibutramine (CHEBI:9137) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine |
| Synonyms | Source |
|---|---|
| Sibutramine | KEGG COMPOUND |
| racemic sibutramine | DrugCentral |
| BTS 54524 | DrugCentral |
| didesmethylsibutramine | DrugCentral |
| sibutramine HCl | DrugCentral |
| (+/-)-Sibutramine | DrugCentral |
| Brand Names | Source |
|---|---|
| Reductil | ChemIDplus |
| Butramin | ChemIDplus |
| Medaria | ChemIDplus |
| Meridia | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07247 | KEGG COMPOUND |
| Sibutramine | Wikipedia |
| DB01105 | DrugBank |
| CN101897685 | Patent |
| CN101890017 | Patent |
| D08513 | KEGG DRUG |
| LSM-5000 | LINCS |
| 2440 | DrugCentral |
| HMDB0015237 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:106650-56-0 | KEGG COMPOUND |
| CAS:106650-56-0 | ChemIDplus |
| Citations |
|---|