EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30FN7O3 |
| Net Charge | 0 |
| Average Mass | 507.570 |
| Monoisotopic Mass | 507.23942 |
| SMILES | CCN(CCO)CCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)nn3)ncnc2c1 |
| InChI | InChI=1S/C26H30FN7O3/c1-2-34(10-11-35)9-4-12-37-21-7-8-22-23(16-21)28-17-29-26(22)31-24-14-20(32-33-24)15-25(36)30-19-6-3-5-18(27)13-19/h3,5-8,13-14,16-17,35H,2,4,9-12,15H2,1H3,(H,30,36)(H2,28,29,31,32,33) |
| InChIKey | QYZOGCMHVIGURT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Aurora kinase inhibitor Any protein kinase inhibitor that inhibits the action of an Aurora kinase (a group of serine/threonine kinases that are essential for cell proliferation). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD-1152 (CHEBI:91367) has role antineoplastic agent (CHEBI:35610) |
| AZD-1152 (CHEBI:91367) has role Aurora kinase inhibitor (CHEBI:70770) |
| AZD-1152 (CHEBI:91367) is a anilide (CHEBI:13248) |
| AZD-1152 (CHEBI:91367) is a monofluorobenzenes (CHEBI:83575) |
| AZD-1152 (CHEBI:91367) is a primary alcohol (CHEBI:15734) |
| AZD-1152 (CHEBI:91367) is a pyrazoles (CHEBI:26410) |
| AZD-1152 (CHEBI:91367) is a quinazolines (CHEBI:38530) |
| AZD-1152 (CHEBI:91367) is a secondary amino compound (CHEBI:50995) |
| AZD-1152 (CHEBI:91367) is a secondary carboxamide (CHEBI:140325) |
| AZD-1152 (CHEBI:91367) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| AZT-1152 (CHEBI:167636) has functional parent AZD-1152 (CHEBI:91367) |
| IUPAC Name |
|---|
| 2-{3-[(7-{3-[ethyl(2-hydroxyethyl)amino]propoxy}quinazolin-4-yl)amino]-1H-pyrazol-5-yl}-N-(3-fluorophenyl)acetamide |
| Synonyms | Source |
|---|---|
| AZD1152 | ChEBI |
| AZD-2811 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1067 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:722544-51-6 | ChemIDplus |
| Citations |
|---|