EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H15ClF2N4O2 |
| Net Charge | 0 |
| Average Mass | 476.870 |
| Monoisotopic Mass | 476.08516 |
| SMILES | O=C(O)c1ccc(Nc2ncc3c(n2)-c2ccc(Cl)cc2C(c2c(F)cccc2F)=NC3)cc1 |
| InChI | InChI=1S/C25H15ClF2N4O2/c26-15-6-9-17-18(10-15)23(21-19(27)2-1-3-20(21)28)29-11-14-12-30-25(32-22(14)17)31-16-7-4-13(5-8-16)24(33)34/h1-10,12H,11H2,(H,33,34)(H,30,31,32) |
| InChIKey | HHFBDROWDBDFBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid (CHEBI:91366) has role antineoplastic agent (CHEBI:35610) |
| 4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid (CHEBI:91366) is a benzazepine (CHEBI:35676) |
| Synonyms | Source |
|---|---|
| mln-8054 | ChEMBL |
| Mln8054 | ChEMBL |
| MLN 8054 | ChEMBL |
| MLN-8054 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1066 | LINCS |
| Citations |
|---|