EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H33N7O |
| Net Charge | 0 |
| Average Mass | 507.642 |
| Monoisotopic Mass | 507.27466 |
| SMILES | CCn1cc(-c2ccnc3nc(-c4cccc(CN(C)C)c4)cc23)c(-c2ccc(NC(=O)N(C)C)cc2)n1 |
| InChI | InChI=1S/C30H33N7O/c1-6-37-19-26(28(34-37)21-10-12-23(13-11-21)32-30(38)36(4)5)24-14-15-31-29-25(24)17-27(33-29)22-9-7-8-20(16-22)18-35(2)3/h7-17,19H,6,18H2,1-5H3,(H,31,33)(H,32,38) |
| InChIKey | QTBWCSQGBMPECM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[4-[4-[2-[3-[(dimethylamino)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-ethyl-3-pyrazolyl]phenyl]-1,1-dimethylurea (CHEBI:91362) has role antineoplastic agent (CHEBI:35610) |
| 3-[4-[4-[2-[3-[(dimethylamino)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-ethyl-3-pyrazolyl]phenyl]-1,1-dimethylurea (CHEBI:91362) is a pyrazoles (CHEBI:26410) |
| 3-[4-[4-[2-[3-[(dimethylamino)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-ethyl-3-pyrazolyl]phenyl]-1,1-dimethylurea (CHEBI:91362) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| gsk-1070916 | ChEMBL |
| Gsk-1070916 | ChEMBL |
| GSK1070916 | ChEMBL |
| Gsk-1070916a | ChEMBL |
| GSK 1070916A | ChEMBL |
| GSK1070916A | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1062 | LINCS |
| Citations |
|---|