EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14ClF2IN2O2 |
| Net Charge | 0 |
| Average Mass | 478.664 |
| Monoisotopic Mass | 477.97566 |
| SMILES | O=C(NOCC1CC1)c1ccc(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C17H14ClF2IN2O2/c18-12-7-10(21)3-6-14(12)22-16-11(4-5-13(19)15(16)20)17(24)23-25-8-9-1-2-9/h3-7,9,22H,1-2,8H2,(H,23,24) |
| InChIKey | GFMMXOIFOQCCGU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide (CHEBI:91353) has role antineoplastic agent (CHEBI:35610) |
| 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide (CHEBI:91353) is a aminobenzoic acid (CHEBI:22495) |
| Synonyms | Source |
|---|---|
| ci-1040 | ChEMBL |
| Ci 1040 | ChEMBL |
| Ci-1040 | ChEMBL |
| PD-18435 | ChEMBL |
| PD-184352 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1048 | LINCS |
| Citations |
|---|