EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N8OS |
| Net Charge | 0 |
| Average Mass | 464.599 |
| Monoisotopic Mass | 464.21068 |
| SMILES | Cc1cc(Nc2cc(N3CCN(C)CC3)nc(Sc3ccc(NC(=O)C4CC4)cc3)n2)nn1 |
| InChI | InChI=1S/C23H28N8OS/c1-15-13-20(29-28-15)25-19-14-21(31-11-9-30(2)10-12-31)27-23(26-19)33-18-7-5-17(6-8-18)24-22(32)16-3-4-16/h5-8,13-14,16H,3-4,9-12H2,1-2H3,(H,24,32)(H2,25,26,27,28,29) |
| InChIKey | GCIKSSRWRFVXBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-[[4-(4-methyl-1-piperazinyl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl]thio]phenyl]cyclopropanecarboxamide (CHEBI:91336) has role antineoplastic agent (CHEBI:35610) |
| N-[4-[[4-(4-methyl-1-piperazinyl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl]thio]phenyl]cyclopropanecarboxamide (CHEBI:91336) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| tozasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-0457 | ChEMBL |
| tozasertib | ChEMBL |
| VX-680 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1021 | LINCS |
| Citations |
|---|