EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18F3N3O4S |
| Net Charge | 0 |
| Average Mass | 477.464 |
| Monoisotopic Mass | 477.09701 |
| SMILES | COc1cc2ncn(-c3cc(OCc4ccccc4C(F)(F)F)c(C(N)=O)s3)c2cc1OC |
| InChI | InChI=1S/C22H18F3N3O4S/c1-30-16-7-14-15(8-17(16)31-2)28(11-27-14)19-9-18(20(33-19)21(26)29)32-10-12-5-3-4-6-13(12)22(23,24)25/h3-9,11H,10H2,1-2H3,(H2,26,29) |
| InChIKey | JSKUWFIZUALZLX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW843682X (CHEBI:91334) has role antineoplastic agent (CHEBI:35610) |
| GW843682X (CHEBI:91334) has role apoptosis inducer (CHEBI:68495) |
| GW843682X (CHEBI:91334) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| GW843682X (CHEBI:91334) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| GW843682X (CHEBI:91334) is a aromatic ether (CHEBI:35618) |
| GW843682X (CHEBI:91334) is a benzimidazoles (CHEBI:22715) |
| GW843682X (CHEBI:91334) is a primary carboxamide (CHEBI:140324) |
| GW843682X (CHEBI:91334) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-{[2-(trifluoromethyl)benzyl]oxy}thiophene-2-carboxamide |
| Synonyms | Source |
|---|---|
| 5-(5,6-dimethoxy-1-benzimidazolyl)-3-[[2-(trifluoromethyl)phenyl]methoxy]-2-thiophenecarboxamide | ChEBI |
| 5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-{[2-(trifluoromethyl)phenyl]methoxy}thiophene-2-carboxamide | IUPAC |
| GW843682 | ChEBI |
| GW 843682X | ChEBI |
| GW-843682X | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1014 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:660868-91-7 | ChEBI |
| Citations |
|---|