EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28F3N5O2S |
| Net Charge | 0 |
| Average Mass | 543.615 |
| Monoisotopic Mass | 543.19158 |
| SMILES | C[C@@H](Oc1cc(-n2cnc3ccc(CN4CCN(C)CC4)cc32)sc1C(N)=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H28F3N5O2S/c1-17(19-5-3-4-6-20(19)27(28,29)30)37-23-14-24(38-25(23)26(31)36)35-16-32-21-8-7-18(13-22(21)35)15-34-11-9-33(2)10-12-34/h3-8,13-14,16-17H,9-12,15H2,1-2H3,(H2,31,36)/t17-/m1/s1 |
| InChIKey | ZHJGWYRLJUCMRT-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK461364 (CHEBI:91333) has role antineoplastic agent (CHEBI:35610) |
| GSK461364 (CHEBI:91333) has role apoptosis inducer (CHEBI:68495) |
| GSK461364 (CHEBI:91333) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| GSK461364 (CHEBI:91333) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| GSK461364 (CHEBI:91333) is a N-methylpiperazine (CHEBI:46920) |
| GSK461364 (CHEBI:91333) is a benzimidazoles (CHEBI:22715) |
| GSK461364 (CHEBI:91333) is a ether (CHEBI:25698) |
| GSK461364 (CHEBI:91333) is a primary carboxamide (CHEBI:140324) |
| GSK461364 (CHEBI:91333) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 5-{6-[(4-methylpiperazin-1-yl)methyl]-1H-benzimidazol-1-yl}-3-{(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy}thiophene-2-carboxamide |
| Synonyms | Source |
|---|---|
| 5-[6-[(4-methyl-1-piperazinyl)methyl]-1-benzimidazolyl]-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]-2-thiophenecarboxamide | ChEBI |
| GSK 461364 | ChEBI |
| GSK-461364 | ChEBI |
| GSK 461364A | ChEBI |
| GSK-461364A | ChEBI |
| GSK461364A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1013 | LINCS |
| US2010256376 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:929095-18-1 | ChEBI |
| Citations |
|---|