EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N5O4 |
| Net Charge | 0 |
| Average Mass | 465.554 |
| Monoisotopic Mass | 465.23760 |
| SMILES | COc1ccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)cc1CO |
| InChI | InChI=1S/C25H31N5O4/c1-16-14-33-10-8-29(16)24-20-5-6-21(18-4-7-22(32-3)19(12-18)13-31)26-23(20)27-25(28-24)30-9-11-34-15-17(30)2/h4-7,12,16-17,31H,8-11,13-15H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | KVLFRAWTRWDEDF-IRXDYDNUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD-8055 (CHEBI:91329) has role antineoplastic agent (CHEBI:35610) |
| AZD-8055 (CHEBI:91329) has role apoptosis inducer (CHEBI:68495) |
| AZD-8055 (CHEBI:91329) has role mTOR inhibitor (CHEBI:68481) |
| AZD-8055 (CHEBI:91329) is a benzyl alcohols (CHEBI:22743) |
| AZD-8055 (CHEBI:91329) is a morpholines (CHEBI:38785) |
| AZD-8055 (CHEBI:91329) is a pyridopyrimidine (CHEBI:38932) |
| AZD-8055 (CHEBI:91329) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| {5-[2,4-bis(3S)(3-methylmorpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl}methanol |
| Synonyms | Source |
|---|---|
| AZD 8055 | ChemIDplus |
| AZD8055 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1007 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13107120 | Reaxys |
| CAS:1009298-09-2 | ChemIDplus |
| Citations |
|---|