EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19ClN4O5 |
| Net Charge | 0 |
| Average Mass | 454.870 |
| Monoisotopic Mass | 454.10440 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)on4)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C22H19ClN4O5/c1-12-8-21(27-32-12)26-22(28)25-16-5-4-13(9-15(16)23)31-18-6-7-24-17-11-20(30-3)19(29-2)10-14(17)18/h4-11H,1-3H3,(H2,25,26,27,28) |
| InChIKey | SPMVMDHWKHCIDT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tivozanib (CHEBI:91327) has role antineoplastic agent (CHEBI:35610) |
| tivozanib (CHEBI:91327) has role apoptosis inducer (CHEBI:68495) |
| tivozanib (CHEBI:91327) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| tivozanib (CHEBI:91327) is a aromatic ether (CHEBI:35618) |
| tivozanib (CHEBI:91327) is a isoxazoles (CHEBI:55373) |
| tivozanib (CHEBI:91327) is a monochlorobenzenes (CHEBI:83403) |
| tivozanib (CHEBI:91327) is a phenylureas (CHEBI:134043) |
| tivozanib (CHEBI:91327) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 1-{2-chloro-4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-3-(5-methyl-1,2-oxazol-3-yl)urea |
| INNs | Source |
|---|---|
| tivozanib | WHO MedNet |
| tivozanib | WHO MedNet |
| tivozanib | WHO MedNet |
| tivozanibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[2-chloro-4-[(6,7-dimethoxy-4-quinolinyl)oxy]phenyl]-3-(5-methyl-3-isoxazolyl)urea | ChEBI |
| AV 951 | DrugBank |
| AV-951 | DrugBank |
| AV951 | DrugBank |
| N-[2-chloro-4-[(6,7-dimethoxy-4-quinolyl)oxy]phenyl]-N'-(5-methyl-3-isoxazolyl)urea | ChEBI |
| Kil 8951 | ChEBI |
| Citations |
|---|