EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
| InChI | InChI=1S/C16H12O7/c1-22-15-10(19)6-9(18)11-12(20)13(21)14(23-16(11)15)7-2-4-8(17)5-3-7/h2-6,17-19,21H,1H3 |
| InChIKey | AZFYHRHUTXBGJS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorbus aria (ncbitaxon:186520) | - | PubMed (18635332) | |
| Sorbus intermedia (ncbitaxon:691236) | - | PubMed (18635332) | |
| Sorbus aucuparia (ncbitaxon:36599) | - | PubMed (18635332) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sexangularetin (CHEBI:9131) has functional parent kaempferol (CHEBI:28499) |
| sexangularetin (CHEBI:9131) has role plant metabolite (CHEBI:76924) |
| sexangularetin (CHEBI:9131) is a 7-hydroxyflavonol (CHEBI:52267) |
| sexangularetin (CHEBI:9131) is a monomethoxyflavone (CHEBI:25401) |
| sexangularetin (CHEBI:9131) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| Herbacetin 8-methyl ether | KEGG COMPOUND |
| 8-methoxykaempferol | ChEBI |
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-methoxy-chromen-4-one | ChEBI |
| 3,5,7,4'-tetrahydroxy-8-methoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10185 | KEGG COMPOUND |
| C00001100 | KNApSAcK |
| LMPK12113150 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:324815 | Reaxys |
| CAS:571-74-4 | KEGG COMPOUND |
| CAS:571-74-4 | ChemIDplus |
| Citations |
|---|