EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@]1([C@@](C)(O)CC(O)CC(C)(C)O)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)CCC3=C)CCC[C@]12C |
| InChI | InChI=1S/C27H44O4/c1-18-8-11-21(28)15-20(18)10-9-19-7-6-14-26(4)23(19)12-13-24(26)27(5,31)17-22(29)16-25(2,3)30/h9-10,21-24,28-31H,1,6-8,11-17H2,2-5H3/b19-9+,20-10-/t21-,22?,23-,24-,26-,27-/m0/s1 |
| InChIKey | NFZNZUWOOKEBKC-GRHFVJACSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25727742) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (25727742) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S,23,25)-trihydroxyvitamin D3 (CHEBI:91308) has role human metabolite (CHEBI:77746) |
| (20S,23,25)-trihydroxyvitamin D3 (CHEBI:91308) has role rat metabolite (CHEBI:86264) |
| (20S,23,25)-trihydroxyvitamin D3 (CHEBI:91308) is a D3 vitamins (CHEBI:73558) |
| (20S,23,25)-trihydroxyvitamin D3 (CHEBI:91308) is a hydroxycalciol (CHEBI:47042) |
| (20S,23,25)-trihydroxyvitamin D3 (CHEBI:91308) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (3S,5Z,7E)-9,10-secocholesta-5,7,10-triene-3,20,23,25-tetrol |
| Synonym | Source |
|---|---|
| 20S,23,25(OH)3D3 | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 20S,23,25-trihydroxycholecalciferol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28472927 | Reaxys |
| Citations |
|---|