EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H50NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 495.630 |
| Monoisotopic Mass (excl. R groups) | 495.33249 |
| SMILES | *C(=O)O[C@H](CO)COP(=O)([O-])OCC[N+](C)(C)C |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS90) | ||
| - | MetaboLights (MTBLS93) | ||
| - | PubMed (25502724) | ||
| - | MetaboLights (MTBLS124) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylcholine(0:0/16:0) (CHEBI:91297) has role human metabolite (CHEBI:77746) |
| lysophosphatidylcholine(0:0/16:0) (CHEBI:91297) is a 2-acyl-sn-glycero-3-phosphocholine (CHEBI:57875) |
| lysophosphatidylcholine(0:0/16:0) (CHEBI:91297) is a lysophosphatidylcholine 16:0 (CHEBI:64563) |
| Incoming Relation(s) |
| 2-palmitoyl-sn-glycero-3-phosphocholine (CHEBI:76078) is a lysophosphatidylcholine(0:0/16:0) (CHEBI:91297) |
| Synonyms | Source |
|---|---|
| LysoPC(0:0/16:0) | ChEBI |
| LPC(0:0/16:0) | ChEBI |
| Citations |
|---|