EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | CC/C=C\C/C=C\CC(=O)/C=C/C=C\C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H30O3/c1-2-3-4-5-12-15-18-21(23)19-16-13-10-8-6-7-9-11-14-17-20-22(24)25/h3-4,6-7,10-16,19H,2,5,8-9,17-18,20H2,1H3,(H,24,25)/b4-3-,7-6-,13-10-,14-11-,15-12-,19-16+ |
| InChIKey | CTOFGDVNVOUNPL-BGKMTWLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25586183) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-oxo-DoHE (CHEBI:91293) has role human xenobiotic metabolite (CHEBI:76967) |
| 14-oxo-DoHE (CHEBI:91293) is a enone (CHEBI:51689) |
| 14-oxo-DoHE (CHEBI:91293) is a oxodocosahexaenoic acid (CHEBI:134542) |
| 14-oxo-DoHE (CHEBI:91293) is conjugate acid of 14-oxo-DoHE(1−) (CHEBI:90867) |
| Incoming Relation(s) |
| 14-oxo-DoHE(1−) (CHEBI:90867) is conjugate base of 14-oxo-DoHE (CHEBI:91293) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,12E,16Z,19Z)-14-oxodocosa-4,7,10,12,16,19-hexaenoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27937079 | Reaxys |
| Citations |
|---|