EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCCC(/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O)OO |
| InChI | InChI=1S/C20H32O4/c1-2-3-13-16-19(24-23)17-14-11-9-7-5-4-6-8-10-12-15-18-20(21)22/h4-5,8-11,14,17,19,23H,2-3,6-7,12-13,15-16,18H2,1H3,(H,21,22)/b5-4-,10-8-,11-9-,17-14+ |
| InChIKey | BFWYTORDSFIVKP-USWFWKISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10542053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-HPETE (CHEBI:91271) has role human xenobiotic metabolite (CHEBI:76967) |
| 15-HPETE (CHEBI:91271) is a HPETE (CHEBI:24644) |
| 15-HPETE (CHEBI:91271) is conjugate acid of 15-HPETE(1−) (CHEBI:90821) |
| Incoming Relation(s) |
| 15(S)-HPETE (CHEBI:15628) is a 15-HPETE (CHEBI:91271) |
| 15-HPETE(1−) (CHEBI:90821) is conjugate base of 15-HPETE (CHEBI:91271) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,13E)-15-hydroperoxyicosa-5,8,11,13-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 15-hydroperoxy-5,8,11,13-eicosatetraenoic acid | ChemIDplus |
| 15-hydroperoxy-(5Z,8Z,11Z,13E)-eicosatetraenoic acid | ChEBI |
| 15-hydroperoxy-(5Z,8Z,11Z,13E)-icosatetraenoic acid | ChEBI |
| (5Z,8Z,11Z,13E)-15-hydroperoxy-5,8,11,13-icosatetraenoic acid | ChEBI |
| (5Z,8Z,11Z,13E)-15-hydroperoxyicosatetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0062688 | HMDB |
| LMFA03060102 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2474123 | Reaxys |
| CAS:67675-14-3 | ChemIDplus |
| Citations |
|---|