EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O6 |
| Net Charge | 0 |
| Average Mass | 394.508 |
| Monoisotopic Mass | 394.23554 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)C[C@@H](C)[C@](O)(CCC3=CC(=O)OC3O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C22H34O6/c1-13-11-16(27-14(2)23)18-20(3,4)8-6-9-21(18,5)22(13,26)10-7-15-12-17(24)28-19(15)25/h12-13,16,18-19,25-26H,6-11H2,1-5H3/t13-,16-,18+,19?,21+,22-/m1/s1 |
| InChIKey | ZHDFOHJIRGVVGC-XEBAKSHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex agnus-castus (ncbitaxon:54477) | fruit (BTO:0000486) | PubMed (21163339) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| viteagnusin I (CHEBI:91270) has role plant metabolite (CHEBI:76924) |
| viteagnusin I (CHEBI:91270) is a acetate ester (CHEBI:47622) |
| viteagnusin I (CHEBI:91270) is a butenolide (CHEBI:50523) |
| viteagnusin I (CHEBI:91270) is a carbobicyclic compound (CHEBI:36785) |
| viteagnusin I (CHEBI:91270) is a labdane diterpenoid (CHEBI:36770) |
| viteagnusin I (CHEBI:91270) is a lactol (CHEBI:38131) |
| viteagnusin I (CHEBI:91270) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,3R,4R,4aS,8aS)-4-hydroxy-4-[2-(2-hydroxy-5-oxo-2,5-dihydrofuran-3-yl)ethyl]-3,4a,8,8-tetramethyldecahydronaphthalen-1-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21884257 | Reaxys |
| Citations |
|---|