EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)C[C@@H](C)[C@](O)(CCC3=CC(=O)OC3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C22H34O5/c1-14-11-17(27-15(2)23)19-20(3,4)8-6-9-21(19,5)22(14,25)10-7-16-12-18(24)26-13-16/h12,14,17,19,25H,6-11,13H2,1-5H3/t14-,17-,19+,21+,22-/m1/s1 |
| InChIKey | FBWWXAGANVJTLU-HEXLTJKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex agnus-castus (ncbitaxon:54477) | fruit (BTO:0000486) | PubMed (17262892) | |
| Vitex trifolia (ncbitaxon:204215) | - | PubMed (15621610) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitexilactone (CHEBI:91267) has role antineoplastic agent (CHEBI:35610) |
| vitexilactone (CHEBI:91267) has role apoptosis inducer (CHEBI:68495) |
| vitexilactone (CHEBI:91267) has role plant metabolite (CHEBI:76924) |
| vitexilactone (CHEBI:91267) is a acetate ester (CHEBI:47622) |
| vitexilactone (CHEBI:91267) is a butenolide (CHEBI:50523) |
| vitexilactone (CHEBI:91267) is a carbobicyclic compound (CHEBI:36785) |
| vitexilactone (CHEBI:91267) is a labdane diterpenoid (CHEBI:36770) |
| vitexilactone (CHEBI:91267) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,3R,4R,4aS,8aS)-4-hydroxy-3,4a,8,8-tetramethyl-4-[2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]decahydronaphthalen-1-yl acetate |
| Manual Xrefs | Databases |
|---|---|
| C00022251 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1265867 | Reaxys |
| CAS:61263-49-8 | ChemIDplus |
| Citations |
|---|