EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38O5 |
| Net Charge | 0 |
| Average Mass | 406.563 |
| Monoisotopic Mass | 406.27192 |
| SMILES | C=CC(C)(O)CC[C@@]1(C)C2=C([C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1C)C(C)(C)CCC2 |
| InChI | InChI=1S/C24H38O5/c1-9-23(7,27)13-14-24(8)15(2)20(28-16(3)25)21(29-17(4)26)19-18(24)11-10-12-22(19,5)6/h9,15,20-21,27H,1,10-14H2,2-8H3/t15-,20-,21+,23?,24-/m1/s1 |
| InChIKey | JSGVRMXIAILPPO-FWPWNEHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex trifolia (ncbitaxon:204215) | - | PubMed (15621610) | |
| Vitex negundo (ncbitaxon:361442) | - | PubMed (23403897) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitetrifolin D (CHEBI:91266) has role antineoplastic agent (CHEBI:35610) |
| vitetrifolin D (CHEBI:91266) has role apoptosis inducer (CHEBI:68495) |
| vitetrifolin D (CHEBI:91266) has role plant metabolite (CHEBI:76924) |
| vitetrifolin D (CHEBI:91266) is a acetate ester (CHEBI:47622) |
| vitetrifolin D (CHEBI:91266) is a carbobicyclic compound (CHEBI:36785) |
| vitetrifolin D (CHEBI:91266) is a labdane diterpenoid (CHEBI:36770) |
| vitetrifolin D (CHEBI:91266) is a olefinic compound (CHEBI:78840) |
| vitetrifolin D (CHEBI:91266) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,2R,3S,4R)-4-(3-hydroxy-3-methylpent-4-en-1-yl)-3,4,8,8-tetramethyl-1,2,3,4,5,6,7,8-octahydronaphthalene-1,2-diyl diacetate |
| Manual Xrefs | Databases |
|---|---|
| C00033484 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9160882 | Reaxys |
| CAS:351427-18-4 | KEGG COMPOUND |
| Citations |
|---|