EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O4 |
| Net Charge | 0 |
| Average Mass | 362.510 |
| Monoisotopic Mass | 362.24571 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)C[C@@H](C)[C@](O)(CCc3ccoc3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C22H34O4/c1-15-13-18(26-16(2)23)19-20(3,4)9-6-10-21(19,5)22(15,24)11-7-17-8-12-25-14-17/h8,12,14-15,18-19,24H,6-7,9-11,13H2,1-5H3/t15-,18-,19+,21+,22-/m1/s1 |
| InChIKey | QKHCQFQIJKXMOE-UGFIEOPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex rotundifolia (ncbitaxon:413484) | fruit (BTO:0000486) | PubMed (11536386) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rotundifuran (CHEBI:91265) has role antineoplastic agent (CHEBI:35610) |
| rotundifuran (CHEBI:91265) has role apoptosis inducer (CHEBI:68495) |
| rotundifuran (CHEBI:91265) has role plant metabolite (CHEBI:76924) |
| rotundifuran (CHEBI:91265) is a acetate ester (CHEBI:47622) |
| rotundifuran (CHEBI:91265) is a carbobicyclic compound (CHEBI:36785) |
| rotundifuran (CHEBI:91265) is a furans (CHEBI:24129) |
| rotundifuran (CHEBI:91265) is a labdane diterpenoid (CHEBI:36770) |
| rotundifuran (CHEBI:91265) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,3R,4R,4aS,8aS)-4-[2-(furan-3-yl)ethyl]-4-hydroxy-3,4a,8,8-tetramethyldecahydronaphthalen-1-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1435870 | Reaxys |
| CAS:50656-65-0 | ChemIDplus |
| Citations |
|---|