EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32Cl2N6 |
| Net Charge | 0 |
| Average Mass | 535.523 |
| Monoisotopic Mass | 534.20655 |
| SMILES | Clc1ccc2c(N3CCN(CCCN4CCN(c5ccnc6cc(Cl)ccc56)CC4)CC3)ccnc2c1 |
| InChI | InChI=1S/C29H32Cl2N6/c30-22-2-4-24-26(20-22)32-8-6-28(24)36-16-12-34(13-17-36)10-1-11-35-14-18-37(19-15-35)29-7-9-33-27-21-23(31)3-5-25(27)29/h2-9,20-21H,1,10-19H2 |
| InChIKey | UCRHFBCYFMIWHC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperaquine (CHEBI:91231) has role antimalarial (CHEBI:38068) |
| piperaquine (CHEBI:91231) is a N-arylpiperazine (CHEBI:46848) |
| piperaquine (CHEBI:91231) is a aminoquinoline (CHEBI:36709) |
| piperaquine (CHEBI:91231) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 7-chloro-4-(4-{3-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]propyl}piperazin-1-yl)quinoline |
| Synonyms | Source |
|---|---|
| 1,3-bis[4-(7-chloroquinolin-4-yl)piperazin-1-yl]propane | ChEBI |
| piperaquinoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4193 | DrugCentral |
| Piperaquine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:905079 | Reaxys |
| CAS:4085-31-8 | ChemIDplus |
| Citations |
|---|