EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15NO7S |
| Net Charge | 0 |
| Average Mass | 365.363 |
| Monoisotopic Mass | 365.05692 |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)Nc2ccc(C(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H15NO7S/c1-10-2-5-12(6-3-10)25(22,23)24-9-15(19)17-11-4-7-13(16(20)21)14(18)8-11/h2-8,18H,9H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | HWNUSGNZBAISFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | STAT3 inhibitor An inhibitor of signal transducer and activator of transcription 3 (STAT3) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S3I-201 (CHEBI:91224) has role STAT3 inhibitor (CHEBI:87183) |
| S3I-201 (CHEBI:91224) is a amidobenzoic acid (CHEBI:48470) |
| S3I-201 (CHEBI:91224) is a monohydroxybenzoic acid (CHEBI:25389) |
| S3I-201 (CHEBI:91224) is a tosylate ester (CHEBI:83351) |
| IUPAC Name |
|---|
| 2-hydroxy-4-{2-[(4-methylbenzene-1-sulfonyl)oxy]acetamido}benzoic acid |
| Synonyms | Source |
|---|---|
| NSC 74859 | ChEBI |
| S31-201 | ChemIDplus |
| NSC-74859 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-6243 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15603473 | Reaxys |
| CAS:501919-59-1 | ChemIDplus |