EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2 |
| Net Charge | 0 |
| Average Mass | 208.264 |
| Monoisotopic Mass | 208.10005 |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1 |
| InChI | InChI=1S/C14H12N2/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9/h3-8H,1-2H3 |
| InChIKey | IYRGXJIJGHOCFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neocuproine (CHEBI:91222) has role chelator (CHEBI:38161) |
| neocuproine (CHEBI:91222) has role copper chelator (CHEBI:166831) |
| neocuproine (CHEBI:91222) is a phenanthrolines (CHEBI:48835) |
| IUPAC Name |
|---|
| 2,9-dimethyl-1,10-phenanthroline |
| Synonyms | Source |
|---|---|
| 2,9-Dimethyl-o-phenanthroline | NIST Chemistry WebBook |
| 2,9-Dimethylphenanthroline | ChemIDplus |
| DMPHEN | ChEBI |
| Neocuproin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-19991 | LINCS |
| Neocuproine | Wikipedia |
| Citations |
|---|