EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26ClFN4O |
| Net Charge | 0 |
| Average Mass | 440.950 |
| Monoisotopic Mass | 440.17792 |
| SMILES | O=C1NCCN1CCN1CCC(c2cn(-c3ccc(F)cc3)c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C24H26ClFN4O/c25-18-1-6-23-21(15-18)22(16-30(23)20-4-2-19(26)3-5-20)17-7-10-28(11-8-17)13-14-29-12-9-27-24(29)31/h1-6,15-17H,7-14H2,(H,27,31) |
| InChIKey | GZKLJWGUPQBVJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sertindole (CHEBI:9122) has role antidepressant (CHEBI:35469) |
| sertindole (CHEBI:9122) has role anxiolytic drug (CHEBI:35474) |
| sertindole (CHEBI:9122) has role H1-receptor antagonist (CHEBI:37955) |
| sertindole (CHEBI:9122) has role second generation antipsychotic (CHEBI:65191) |
| sertindole (CHEBI:9122) has role serotonergic antagonist (CHEBI:48279) |
| sertindole (CHEBI:9122) has role α-adrenergic antagonist (CHEBI:37890) |
| sertindole (CHEBI:9122) is a heteroarylpiperidine (CHEBI:48585) |
| sertindole (CHEBI:9122) is a imidazolidinone (CHEBI:55370) |
| sertindole (CHEBI:9122) is a organochlorine compound (CHEBI:36683) |
| sertindole (CHEBI:9122) is a organofluorine compound (CHEBI:37143) |
| sertindole (CHEBI:9122) is a phenylindole (CHEBI:48559) |
| IUPAC Name |
|---|
| 1-(2-{4-[5-chloro-1-(4-fluorophenyl)-1H-indol-3-yl]piperidin-1-yl}ethyl)imidazolidin-2-one |
| INNs | Source |
|---|---|
| sertindol | ChemIDplus |
| sertindole | WHO MedNet |
| sertindole | KEGG DRUG |
| sertindolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-[2-[4-[5-chloro-1-(4-fluorophenyl)-indol-3-yl]-1-piperidyl]ethyl]imidazolidin-2-one | IUPHAR |
| Sertindole | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Serdolect | DrugBank |
| Serlect | DrugBank |
| SerLect | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2435 | DrugCentral |
| C07567 | KEGG COMPOUND |
| D00561 | KEGG DRUG |
| DB06144 | DrugBank |
| HMDB0015618 | HMDB |
| LSM-5765 | LINCS |
| Sertindole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5364890 | Reaxys |
| CAS:106516-24-9 | KEGG COMPOUND |
| CAS:106516-24-9 | ChemIDplus |
| Citations |
|---|