EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | CCCCCC(O)C(O)/C=C\C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13- |
| InChIKey | MDIUMSLCYIJBQC-YPKPFQOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,12,13-trihydroxyoctadec-10-enoic acid (CHEBI:91217) has role plant metabolite (CHEBI:76924) |
| 9,12,13-trihydroxyoctadec-10-enoic acid (CHEBI:91217) is a long-chain fatty acid (CHEBI:15904) |
| 9,12,13-trihydroxyoctadec-10-enoic acid (CHEBI:91217) is a TriHOME (CHEBI:73765) |
| IUPAC Name |
|---|
| 9,12,13-trihydroxyoctadec-10-enoic acid |
| Synonyms | Source |
|---|---|
| 9,12,13-Todea | ChemIDplus |
| 9,12,13-Trihydroxy-10-octadecenoic acid | ChemIDplus |
| 9,12,13-TriHOME(10) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000169 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22819892 | Reaxys |
| CAS:29907-56-0 | ChemIDplus |
| Citations |
|---|