EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7IN2 |
| Net Charge | 0 |
| Average Mass | 282.084 |
| Monoisotopic Mass | 281.96540 |
| SMILES | Ic1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C10H7IN2/c11-10-6-9(12-7-13-10)8-4-2-1-3-5-8/h1-7H |
| InChIKey | ZTCJXHNJVLUUMR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | macrophage migration inhibitory factor inhibitor Any inhibitor of macrophage migration inhibitory factor (MIF). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-iodo-6-phenylpyrimidine (CHEBI:91213) has role antineoplastic agent (CHEBI:35610) |
| 4-iodo-6-phenylpyrimidine (CHEBI:91213) has role apoptosis inducer (CHEBI:68495) |
| 4-iodo-6-phenylpyrimidine (CHEBI:91213) has role macrophage migration inhibitory factor inhibitor (CHEBI:91214) |
| 4-iodo-6-phenylpyrimidine (CHEBI:91213) is a biaryl (CHEBI:64459) |
| 4-iodo-6-phenylpyrimidine (CHEBI:91213) is a organoiodine compound (CHEBI:37142) |
| 4-iodo-6-phenylpyrimidine (CHEBI:91213) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 4-iodo-6-phenylpyrimidine |
| Synonym | Source |
|---|---|
| 4-IPP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6233 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:639160 | Reaxys |
| Citations |
|---|